Molecular Structure:
CCD No.:CCD00072222
QUINOLINE (D7)
CAS No.:
34071-94-8
Formula:C9 D7 N
MolWeight:136.204
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(2)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | QUINOLINE (D7) |
| CAS： | 34071-94-8 |
| English Synonyms： | QUINOLINE (D7) |
| MDL Number.： | MFCD00145200 |
| H bond acceptor： | 1 |
| H bond donor： | 0 |
| Smile： | [2H]c1c(c(c2c(c1[2H])c(c(c(n2)[2H])[2H])[2H])[2H])[2H] |
| InChiKey： | InChIKey=null |
|
|
| Melting Point： | -17-(-13) DEG C(LIT) |
| Boiling Point： | 237 DEG C(LIT) |
| Density： | DENSITY: 1.151 G/ML AT 25 DEG C |
| Physical Property： | FLASHPOINT: 195.8 DEG F FLASHPOINT: 91 DEG C |
| Comments： | ASSAY METHOD: CP MASS SHIFT: M+7 RIDADR: UN 2656 6.1/PG 3 WGK: 2 |
| Information： | ISOTOPIC PURITY: 97 ATOM % D MW: 135.99 BY ATOM % CALCULATION |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
