* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VANILLIC ACID (RING-13C6) |
English Synonyms: | VANILLIC ACID (RING-13C6) |
MDL Number.: | MFCD00145520 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CO[13c]1[13cH][13c]([13cH][13cH][13c]1O)C(=O)O |
InChi: | InChI=1S/C8H8O4/c1-12-7-4-5(8(10)11)2-3-6(7)9/h2-4,9H,1H3,(H,10,11)/i2+1,3+1,4+1,5+1,6+1,7+1 |
InChiKey: | InChIKey=WKOLLVMJNQIZCI-WBJZHHNVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.