* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VANILLIN (METHOXY-13C) |
English Synonyms: | VANILLIN (METHOXY-13C) |
MDL Number.: | MFCD00145522 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | [13CH3]Oc1cc(ccc1O)C=O |
InChi: | InChI=1S/C8H8O3/c1-11-8-4-6(5-9)2-3-7(8)10/h2-5,10H,1H3/i1+1 |
InChiKey: | InChIKey=MWOOGOJBHIARFG-OUBTZVSYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.