* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | LABOTEST-BB LT00452008 |
English Synonyms: | LABOTEST-BB LT00452008 |
MDL Number.: | MFCD00150828 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | C1COCCN1CCCS(=O)(=O)[O-].O.[Na+] |
InChi: | InChI=1S/C7H15NO4S.Na.H2O/c9-13(10,11)7-1-2-8-3-5-12-6-4-8;;/h1-7H2,(H,9,10,11);;1H2/q;+1;/p-1 |
InChiKey: | InChIKey=ZEDAGFBWUVYFQU-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.