* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LITHIUM CARBONATE-7LI |
| English Synonyms: | LITHIUM CARBONATE-7LI |
| MDL Number.: | MFCD00151287 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | [7Li+].[7Li+].C(=O)([O-])[O-] |
| InChi: | InChI=1S/CH2O3.2Li/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2/i;2*1+0 |
| InChiKey: | InChIKey=XGZVUEUWXADBQD-LDAMREJGSA-L |
|
|
| Melting Point: | 720 DEG C(LIT) |
| Comments: | MASS SHIFT: DEPLETED WGK: 3 |
| Information: | ISOTOPIC PURITY: 99 ATOM % 7LI MW: 74.02 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.