* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LEUKOTRIENE B4-1,2-13C2 |
| English Synonyms: | LEUKOTRIENE B4-1,2-13C2 ; [5S,12R]-DIHYDROXY-[6Z,8E,10E,14Z]-EICOSATETRAENO ACID-1,2-13C2 |
| MDL Number.: | MFCD00151493 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | CCCCC/C=C\C[C@H](/C=C/C=C/C=C\[C@H](CC[13CH2][13C](=O)O)O)O |
| InChi: | InChI=1S/C20H32O4/c1-2-3-4-5-6-9-13-18(21)14-10-7-8-11-15-19(22)16-12-17-20(23)24/h6-11,14-15,18-19,21-22H,2-5,12-13,16-17H2,1H3,(H,23,24)/b8-7+,9-6-,14-10+,15-11-/t18-,19-/m1/s1/i17+1,20+1 |
| InChiKey: | InChIKey=VNYSSYRCGWBHLG-DSGYIICGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.