* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-CHLORO-2H-CHROMEN-2-ONE |
CAS: | 19063-54-8 |
English Synonyms: | 7-CHLORO-2H-CHROMEN-2-ONE ; 7-CHLORO-2H-1-BENZOPYRAN-2-ONE |
MDL Number.: | MFCD00152031 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1cc(cc2c1ccc(=O)o2)Cl |
InChi: | InChI=1S/C9H5ClO2/c10-7-3-1-6-2-4-9(11)12-8(6)5-7/h1-5H |
InChiKey: | InChIKey=BWPNKJCEDYRUCB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.