* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GLUTARYL-GLY-GLY-PHE-AMC |
| CAS: | 70996-06-4 |
| English Synonyms: | GLUTARYL-GLY-GLY-PHE-AMC |
| MDL Number.: | MFCD00152085 |
| H bond acceptor: | 12 |
| H bond donor: | 5 |
| Smile: | Cc1cc(=O)oc2c1ccc(c2)NC(=O)[C@H](Cc3ccccc3)NC(=O)CNC(=O)CNC(=O)CCCC(=O)O |
| InChi: | InChI=1S/C28H30N4O8/c1-17-12-27(38)40-22-14-19(10-11-20(17)22)31-28(39)21(13-18-6-3-2-4-7-18)32-25(35)16-30-24(34)15-29-23(33)8-5-9-26(36)37/h2-4,6-7,10-12,14,21H,5,8-9,13,15-16H2,1H3,(H,29,33)(H,30,34)(H,31,39)(H,32,35)(H,36,37)/t21-/m0/s1 |
| InChiKey: | InChIKey=BJFCLFHIPMBWDB-NRFANRHFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.