* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,3,3',4',6-PENTACHLOROBIPHENYL |
CAS: | 38380-03-9 |
English Synonyms: | 2,3,3',4',6-PCB ; PCB NO 110 ; BZNO 110 ; 2,3,3',4',6-PENTACHLOROBIPHENYL |
MDL Number.: | MFCD00152720 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | c1cc(c(cc1c2c(ccc(c2Cl)Cl)Cl)Cl)Cl |
InChi: | InChI=1S/C12H5Cl5/c13-7-2-1-6(5-10(7)16)11-8(14)3-4-9(15)12(11)17/h1-5H |
InChiKey: | InChIKey=ARXHIJMGSIYYRZ-UHFFFAOYSA-N |
Property |
|
Comments: | FOR ENVIRONMENTAL ANALYSIS RIDADR: UN 3432 9/PG 2 RTECS: DV8201000 UNSPSC: 12000000 WGK: 3 |
Specification: | ANALYTICAL STANDARD |
Safety information |
|
Symbol: | GHS08 GHS09 |
Signal word: | Warning |
Hazard statements: | H373,H410 |
Precautionary statements: | P273,P501 |
hazard symbol: | N |
Risk Code: | R:33,50/53 |
Safe Code: | S:35,60,61 |
UN Code: | 3432 |
WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.