* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-GLN(DOD)-OH |
| CAS: | 28252-49-5 |
| English Synonyms: | Z-GLN(DOD)-OH |
| MDL Number.: | MFCD00153331 |
| H bond acceptor: | 9 |
| H bond donor: | 3 |
| Smile: | COc1ccc(cc1)C(c2ccc(cc2)OC)NC(=O)CC[C@@H](C(=O)O)NC(=O)OCc3ccccc3 |
| InChi: | InChI=1S/C28H30N2O7/c1-35-22-12-8-20(9-13-22)26(21-10-14-23(36-2)15-11-21)30-25(31)17-16-24(27(32)33)29-28(34)37-18-19-6-4-3-5-7-19/h3-15,24,26H,16-18H2,1-2H3,(H,29,34)(H,30,31)(H,32,33)/t24-/m0/s1 |
| InChiKey: | InChIKey=NXGRPCWLXRUYOF-DEOSSOPVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.