* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LHRH (1-5) |
| CAS: | 52434-75-0 |
| English Synonyms: | PGLU-HIS-TRP-SER-TYR ; LHRH (1-5) ; PYR-HWSY ; PYR-HIS-TRP-SER-TYR-OH |
| MDL Number.: | MFCD00153559 |
| H bond acceptor: | 17 |
| H bond donor: | 10 |
| Smile: | c1ccc2c(c1)c(c[nH]2)C[C@@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc3ccc(cc3)O)C(=O)O)NC(=O)[C@H](Cc4c[nH]cn4)NC(=O)[C@@H]5CCC(=O)N5 |
| InChi: | InChI=1S/C34H38N8O9/c43-16-28(33(49)41-27(34(50)51)11-18-5-7-21(44)8-6-18)42-31(47)25(12-19-14-36-23-4-2-1-3-22(19)23)39-32(48)26(13-20-15-35-17-37-20)40-30(46)24-9-10-29(45)38-24/h1-8,14-15,17,24-28,36,43-44H,9-13,16H2,(H,35,37)(H,38,45)(H,39,48)(H,40,46)(H,41,49)(H,42,47)(H,50,51)/t24-,25-,26-,27-,28-/m0/s1 |
| InChiKey: | InChIKey=VVBDLEHCIKUJSA-XLIKFSOKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.