* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | H-D-ALA-PRO-OH |
| CAS: | 61430-12-4 |
| English Synonyms: | H-D-ALA-PRO-OH |
| MDL Number.: | MFCD00153904 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | C[C@H](C(=O)N1CCC[C@H]1C(=O)O)N |
| InChi: | InChI=1S/C8H14N2O3/c1-5(9)7(11)10-4-2-3-6(10)8(12)13/h5-6H,2-4,9H2,1H3,(H,12,13)/t5-,6+/m1/s1 |
| InChiKey: | InChIKey=WPWUFUBLGADILS-RITPCOANSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.