* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OCTYLNITRATE |
| CAS: | 629-39-0 |
| English Synonyms: | OCTYLNITRATE |
| MDL Number.: | MFCD00154208 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CCCCCCCCO[N+](=O)[O-] |
| InChi: | InChI=1S/C8H17NO3/c1-2-3-4-5-6-7-8-12-9(10)11/h2-8H2,1H3 |
| InChiKey: | InChIKey=TXQBMQNFXYOIPT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.