* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BO 1265 |
English Synonyms: | RARECHEM AL BO 1265 |
MDL Number.: | MFCD00154338 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C/C(=C\Br)/C(=O)O |
InChi: | InChI=1S/C4H5BrO2/c1-3(2-5)4(6)7/h2H,1H3,(H,6,7)/b3-2+ |
InChiKey: | InChIKey=PWWIAWDCLANFSS-NSCUHMNNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.