* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZX-IP004481 |
English Synonyms: | ZERENEX ZX-IP004481 |
MDL Number.: | MFCD00154865 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CO[C@@H]1CS(=O)(=O)C[C@H]1OC |
InChi: | InChI=1S/C6H12O4S/c1-9-5-3-11(7,8)4-6(5)10-2/h5-6H,3-4H2,1-2H3/t5-,6-/m1/s1 |
InChiKey: | InChIKey=OSDHRUQHPRZLJH-PHDIDXHHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.