* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | H-LEU-LEU-OME HCL |
| English Synonyms: | LEU-LEU-OME HCL ; H-LEU-LEU-OME HCL |
| MDL Number.: | MFCD00155477 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CC(C)C[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)OC)N.Cl |
| InChi: | InChI=1S/C13H26N2O3.ClH/c1-8(2)6-10(14)12(16)15-11(7-9(3)4)13(17)18-5;/h8-11H,6-7,14H2,1-5H3,(H,15,16);1H/t10-,11-;/m0./s1 |
| InChiKey: | InChIKey=RVXQFTNCULOWRV-ACMTZBLWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.