* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | LYS-ALA NH2 2HCL |
English Synonyms: | LYS-ALA NH2 2HCL |
MDL Number.: | MFCD00155482 |
H bond acceptor: | 6 |
H bond donor: | 4 |
Smile: | C[C@@H](C(=O)N)NC(=O)[C@H](CCCCN)N.Cl.Cl |
InChi: | InChI=1S/C9H20N4O2.2ClH/c1-6(8(12)14)13-9(15)7(11)4-2-3-5-10;;/h6-7H,2-5,10-11H2,1H3,(H2,12,14)(H,13,15);2*1H/t6-,7-;;/m0../s1 |
InChiKey: | InChIKey=ZDORORRNVZAOAL-JFYKYWLVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.