* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Z-GLY-D-LEU-OH |
English Synonyms: | Z-GLY-D-LEU-OH |
MDL Number.: | MFCD00155529 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | CC(C)C[C@H](C(=O)O)NC(=O)CNC(=O)OCc1ccccc1 |
InChi: | InChI=1S/C16H22N2O5/c1-11(2)8-13(15(20)21)18-14(19)9-17-16(22)23-10-12-6-4-3-5-7-12/h3-7,11,13H,8-10H2,1-2H3,(H,17,22)(H,18,19)(H,20,21)/t13-/m1/s1 |
InChiKey: | InChIKey=MRRLFGAIRAUOCS-CYBMUJFWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.