* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-PHE-GLY-GLY-OH |
| CAS: | 37700-64-4 |
| English Synonyms: | Z-PHE-GLY-GLY-OH |
| MDL Number.: | MFCD00155531 |
| H bond acceptor: | 9 |
| H bond donor: | 4 |
| Smile: | c1ccc(cc1)C[C@@H](C(=O)NCC(=O)NCC(=O)O)NC(=O)OCc2ccccc2 |
| InChi: | InChI=1S/C21H23N3O6/c25-18(22-13-19(26)27)12-23-20(28)17(11-15-7-3-1-4-8-15)24-21(29)30-14-16-9-5-2-6-10-16/h1-10,17H,11-14H2,(H,22,25)(H,23,28)(H,24,29)(H,26,27)/t17-/m0/s1 |
| InChiKey: | InChIKey=BKVFAOYJBLSVSK-KRWDZBQOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.