* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-VAL-GLY-OH |
| CAS: | 2790-84-3 |
| English Synonyms: | Z-VAL-GLY-OH ; Z-L-VALYL-L-GLYCINE |
| MDL Number.: | MFCD00155534 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | CC(C)[C@@H](C(=O)NCC(=O)O)NC(=O)OCc1ccccc1 |
| InChi: | InChI=1S/C15H20N2O5/c1-10(2)13(14(20)16-8-12(18)19)17-15(21)22-9-11-6-4-3-5-7-11/h3-7,10,13H,8-9H2,1-2H3,(H,16,20)(H,17,21)(H,18,19)/t13-/m0/s1 |
| InChiKey: | InChIKey=MWOJWUBBCZRMTB-ZDUSSCGKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.