* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-VAL-PNA |
| English Synonyms: | Z-VAL-PNA ; Z-L-VALINE 4-NITROANILIDE |
| MDL Number.: | MFCD00155557 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | CC(C)[C@@H](C(=O)Nc1ccc(cc1)[N+](=O)[O-])NC(=O)OCc2ccccc2 |
| InChi: | InChI=1S/C19H21N3O5/c1-13(2)17(21-19(24)27-12-14-6-4-3-5-7-14)18(23)20-15-8-10-16(11-9-15)22(25)26/h3-11,13,17H,12H2,1-2H3,(H,20,23)(H,21,24)/t17-/m0/s1 |
| InChiKey: | InChIKey=ZILZYWJHUBYWHB-KRWDZBQOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.