* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | H-GLY-PRO-BETANA HCL |
| English Synonyms: | H-GLY-PRO-BETANA HCL |
| MDL Number.: | MFCD00155564 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | c1ccc2cc(ccc2c1)NC(=O)[C@@H]3CCCN3C(=O)CN.Cl |
| InChi: | InChI=1S/C17H19N3O2.ClH/c18-11-16(21)20-9-3-6-15(20)17(22)19-14-8-7-12-4-1-2-5-13(12)10-14;/h1-2,4-5,7-8,10,15H,3,6,9,11,18H2,(H,19,22);1H/t15-;/m0./s1 |
| InChiKey: | InChIKey=QSZQQJFEKQFRJP-RSAXXLAASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.