* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-PHE-BETANA HCL |
English Synonyms: | H-PHE-BETANA HCL |
MDL Number.: | MFCD00155567 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)C[C@@H](C(=O)Nc2ccc3ccccc3c2)N.Cl |
InChi: | InChI=1S/C19H18N2O.ClH/c20-18(12-14-6-2-1-3-7-14)19(22)21-17-11-10-15-8-4-5-9-16(15)13-17;/h1-11,13,18H,12,20H2,(H,21,22);1H/t18-;/m0./s1 |
InChiKey: | InChIKey=SMFHQYDWRZZLDT-FERBBOLQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.