* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-GLY-ALA-PRO-AMC |
| English Synonyms: | Z-GLY-ALA-PRO-AMC |
| MDL Number.: | MFCD00155593 |
| H bond acceptor: | 11 |
| H bond donor: | 3 |
| Smile: | Cc1cc(=O)oc2c1ccc(c2)NC(=O)[C@@H]3CCCN3C(=O)[C@H](C)NC(=O)CNC(=O)OCc4ccccc4 |
| InChi: | InChI=1S/C28H30N4O7/c1-17-13-25(34)39-23-14-20(10-11-21(17)23)31-26(35)22-9-6-12-32(22)27(36)18(2)30-24(33)15-29-28(37)38-16-19-7-4-3-5-8-19/h3-5,7-8,10-11,13-14,18,22H,6,9,12,15-16H2,1-2H3,(H,29,37)(H,30,33)(H,31,35)/t18-,22-/m0/s1 |
| InChiKey: | InChIKey=OWNJYGYPNIJDOB-AVRDEDQJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.