* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-GLY-ARG-AMC HCL |
| English Synonyms: | Z-GLY-ARG-AMC HCL |
| MDL Number.: | MFCD00155594 |
| H bond acceptor: | 12 |
| H bond donor: | 6 |
| Smile: | Cc1cc(=O)oc2c1ccc(c2)NC(=O)[C@H](CCCNC(=N)N)NC(=O)CNC(=O)OCc3ccccc3.Cl |
| InChi: | InChI=1S/C26H30N6O6.ClH/c1-16-12-23(34)38-21-13-18(9-10-19(16)21)31-24(35)20(8-5-11-29-25(27)28)32-22(33)14-30-26(36)37-15-17-6-3-2-4-7-17;/h2-4,6-7,9-10,12-13,20H,5,8,11,14-15H2,1H3,(H,30,36)(H,31,35)(H,32,33)(H4,27,28,29);1H/t20-;/m0./s1 |
| InChiKey: | InChIKey=OCCSIDNKOMRMRK-BDQAORGHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.