* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-PHE-ALA-AMC |
| English Synonyms: | Z-PHE-ALA-AMC |
| MDL Number.: | MFCD00155596 |
| H bond acceptor: | 9 |
| H bond donor: | 3 |
| Smile: | Cc1cc(=O)oc2c1ccc(c2)NC(=O)[C@H](C)NC(=O)[C@H](Cc3ccccc3)NC(=O)OCc4ccccc4 |
| InChi: | InChI=1S/C30H29N3O6/c1-19-15-27(34)39-26-17-23(13-14-24(19)26)32-28(35)20(2)31-29(36)25(16-21-9-5-3-6-10-21)33-30(37)38-18-22-11-7-4-8-12-22/h3-15,17,20,25H,16,18H2,1-2H3,(H,31,36)(H,32,35)(H,33,37)/t20-,25-/m0/s1 |
| InChiKey: | InChIKey=WEABPARIZMGTCK-CPJSRVTESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.