* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Z-D-PHE-ARG-AMC HCL |
English Synonyms: | Z-D-PHE-ARG-AMC HCL |
MDL Number.: | MFCD00155597 |
H bond acceptor: | 12 |
H bond donor: | 6 |
Smile: | Cc1cc(=O)oc2c1ccc(c2)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](Cc3ccccc3)NC(=O)OCc4ccccc4.Cl |
InChi: | InChI=1S/C33H36N6O6.ClH/c1-21-17-29(40)45-28-19-24(14-15-25(21)28)37-30(41)26(13-8-16-36-32(34)35)38-31(42)27(18-22-9-4-2-5-10-22)39-33(43)44-20-23-11-6-3-7-12-23;/h2-7,9-12,14-15,17,19,26-27H,8,13,16,18,20H2,1H3,(H,37,41)(H,38,42)(H,39,43)(H4,34,35,36);1H/t26-,27+;/m0./s1 |
InChiKey: | InChIKey=NXIWJKWURGALDP-MFHXMFJOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.