* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Z-PHE-GLY-AMC |
English Synonyms: | Z-PHE-GLY-AMC |
MDL Number.: | MFCD00155598 |
H bond acceptor: | 9 |
H bond donor: | 3 |
Smile: | Cc1cc(=O)oc2c1ccc(c2)NC(=O)CNC(=O)[C@H](Cc3ccccc3)NC(=O)OCc4ccccc4 |
InChi: | InChI=1S/C29H27N3O6/c1-19-14-27(34)38-25-16-22(12-13-23(19)25)31-26(33)17-30-28(35)24(15-20-8-4-2-5-9-20)32-29(36)37-18-21-10-6-3-7-11-21/h2-14,16,24H,15,17-18H2,1H3,(H,30,35)(H,31,33)(H,32,36)/t24-/m0/s1 |
InChiKey: | InChIKey=QPRWGKCXTGKMRE-DEOSSOPVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.