* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | IBSCREEN-BB BB_NC-1029 |
| English Synonyms: | IBSCREEN-BB BB_NC-1029 |
| MDL Number.: | MFCD00156145 |
| H bond acceptor: | 6 |
| H bond donor: | 5 |
| Smile: | c1cc(c(c2c1[C@H]3c4cc(c(cc4C[C@]3(CO2)O)O)O)O)O |
| InChi: | InChI=1S/C16H14O6/c17-10-2-1-8-13-9-4-12(19)11(18)3-7(9)5-16(13,21)6-22-15(8)14(10)20/h1-4,13,17-21H,5-6H2/t13-,16+/m0/s1 |
| InChiKey: | InChIKey=WZUVPPKBWHMQCE-XJKSGUPXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.