* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZX-IP011904 |
| English Synonyms: | ZERENEX ZX-IP011904 |
| MDL Number.: | MFCD00156667 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | COc1ccccc1CC(=O)c2c(cc(cc2O)O)O |
| InChi: | InChI=1S/C15H14O5/c1-20-14-5-3-2-4-9(14)6-11(17)15-12(18)7-10(16)8-13(15)19/h2-5,7-8,16,18-19H,6H2,1H3 |
| InChiKey: | InChIKey=JXHCBDZUPWMLDA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.