Molecular Structure:
CCD No.:CCD00078324
OTAVA-BB 1358518
Formula:C16 H24 N2 O3
MolWeight:292.377
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1358518 |
| English Synonyms： | OTAVA-BB 1358518 |
| MDL Number.： | MFCD00157621 |
| H bond acceptor： | 5 |
| H bond donor： | 2 |
| Smile： | CCCN(CCC)c1cccc(c1)NC(=O)CCC(=O)O |
| InChi： | InChI=1S/C16H24N2O3/c1-3-10-18(11-4-2)14-7-5-6-13(12-14)17-15(19)8-9-16(20)21/h5-7,12H,3-4,8-11H2,1-2H3,(H,17,19)(H,20,21) |
| InChiKey： | InChIKey=WRSLTHZOTIHTFB-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
