Molecular Structure:
CCD No.:CCD00078481
OTAVA-BB 1831360
Formula:C16 H14 Cl N O
MolWeight:271.746
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1831360 |
| English Synonyms： | OTAVA-BB 1831360 |
| MDL Number.： | MFCD00158851 |
| H bond acceptor： | 2 |
| H bond donor： | 0 |
| Smile： | COc1ccc(cc1)C(Cc2ccc(cc2)Cl)C#N |
| InChi： | InChI=1S/C16H14ClNO/c1-19-16-8-4-13(5-9-16)14(11-18)10-12-2-6-15(17)7-3-12/h2-9,14H,10H2,1H3 |
| InChiKey： | InChIKey=DBYFLAAXHFMYCB-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
