* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | L-HIS-PRO-PHE |
English Synonyms: | L-HIS-PRO-PHE |
MDL Number.: | MFCD00167498 |
H bond acceptor: | 9 |
H bond donor: | 4 |
Smile: | c1ccc(cc1)C[C@@H](C(=O)O)NC(=O)[C@@H]2CCCN2C(=O)[C@H](Cc3c[nH]cn3)N |
InChi: | InChI=1S/C20H25N5O4/c21-15(10-14-11-22-12-23-14)19(27)25-8-4-7-17(25)18(26)24-16(20(28)29)9-13-5-2-1-3-6-13/h1-3,5-6,11-12,15-17H,4,7-10,21H2,(H,22,23)(H,24,26)(H,28,29)/t15-,16-,17-/m0/s1 |
InChiKey: | InChIKey=PBVQWNDMFFCPIZ-ULQDDVLXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.