* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VAL-ILE-HIS-SER |
English Synonyms: | V-I-H-S ; VAL-ILE-HIS-SER |
MDL Number.: | MFCD00167935 |
H bond acceptor: | 12 |
H bond donor: | 7 |
Smile: | CC[C@H](C)[C@@H](C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](CO)C(=O)O)NC(=O)[C@H](C(C)C)N |
InChi: | InChI=1S/C20H34N6O6/c1-5-11(4)16(26-18(29)15(21)10(2)3)19(30)24-13(6-12-7-22-9-23-12)17(28)25-14(8-27)20(31)32/h7,9-11,13-16,27H,5-6,8,21H2,1-4H3,(H,22,23)(H,24,30)(H,25,28)(H,26,29)(H,31,32)/t11-,13-,14-,15-,16-/m0/s1 |
InChiKey: | InChIKey=NRXQHOMUPNKDCI-YDMUCJKGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.