Molecular Structure:
CCD No.:CCD00086519
ZERENEX E/4045048
Formula:C17 H10 Cl N O3
MolWeight:311.723
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/4045048 |
| English Synonyms： | ZERENEX E/4045048 |
| MDL Number.： | MFCD00174441 |
| H bond acceptor： | 4 |
| H bond donor： | 0 |
| Smile： | c1ccc(cc1)C(=O)c2cc(ccc2N3C(=O)C=CC3=O)Cl |
| InChi： | InChI=1S/C17H10ClNO3/c18-12-6-7-14(19-15(20)8-9-16(19)21)13(10-12)17(22)11-4-2-1-3-5-11/h1-10H |
| InChiKey： | InChIKey=NJMSTNJRQFSDPW-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
