* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-IODOQUINAZOLIN-4-OL |
English Synonyms: | 7-IODOQUINAZOLIN-4-OL |
MDL Number.: | MFCD00176566 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cc2c(cc1I)ncnc2O |
InChi: | InChI=1S/C8H5IN2O/c9-5-1-2-6-7(3-5)10-4-11-8(6)12/h1-4H,(H,10,11,12) |
InChiKey: | InChIKey=RZLRWRLAHJWOLF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.