* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-CHLORO-6H-INDOLO[2,3-B]QUINOXALINE |
English Synonyms: | 9-CHLORO-6H-INDOLO[2,3-B]QUINOXALINE |
MDL Number.: | MFCD00178309 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)nc3c4cc(ccc4[nH]c3n2)Cl |
InChi: | InChI=1S/C14H8ClN3/c15-8-5-6-10-9(7-8)13-14(17-10)18-12-4-2-1-3-11(12)16-13/h1-7H,(H,17,18) |
InChiKey: | InChIKey=PSLOAFHZTHDLHB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.