* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL FF 0030 |
English Synonyms: | RARECHEM AL FF 0030 |
MDL Number.: | MFCD00178985 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CCOC(=O)c1cnc(nc1N)S/C=C/C(=O)c2ccc(cc2)C |
InChi: | InChI=1S/C17H17N3O3S/c1-3-23-16(22)13-10-19-17(20-15(13)18)24-9-8-14(21)12-6-4-11(2)5-7-12/h4-10H,3H2,1-2H3,(H2,18,19,20)/b9-8+ |
InChiKey: | InChIKey=JCORKPWXEJHZSU-CMDGGOBGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.