* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZX-CF011205 |
| English Synonyms: | ZERENEX ZX-CF011205 |
| MDL Number.: | MFCD00179061 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | c1cc(ccc1C#N)C2N[C@@H](CS2)C(=O)O |
| InChi: | InChI=1S/C11H10N2O2S/c12-5-7-1-3-8(4-2-7)10-13-9(6-16-10)11(14)15/h1-4,9-10,13H,6H2,(H,14,15)/t9-,10?/m0/s1 |
| InChiKey: | InChIKey=YIALWNWWJOVCJG-RGURZIINSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.