* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-METHYL-9H-FLUOREN-9-OL |
CAS: | 6311-22-4 |
English Synonyms: | 9-METHYL-9H-FLUOREN-9-OL ; 9-METHYLFLUOREN-9-OL |
MDL Number.: | MFCD00183690 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CC1(c2ccccc2-c3c1cccc3)O |
InChi: | InChI=1S/C14H12O/c1-14(15)12-8-4-2-6-10(12)11-7-3-5-9-13(11)14/h2-9,15H,1H3 |
InChiKey: | InChIKey=ZMXJQEIJNHMYDY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.