* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX E/8010710 |
| English Synonyms: | ZERENEX E/8010710 |
| MDL Number.: | MFCD00183947 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | Cc1ccc(cc1)C(=O)Nc2ccc(c(c2)O)C(=O)O |
| InChi: | InChI=1S/C15H13NO4/c1-9-2-4-10(5-3-9)14(18)16-11-6-7-12(15(19)20)13(17)8-11/h2-8,17H,1H3,(H,16,18)(H,19,20) |
| InChiKey: | InChIKey=OZKBOBLQBFLLMA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.