* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-[2,6-DINITRO-4-(TRIFLUOROMETHYL)PHENOXY]-1,1,2,2,3,3,4,4,5,5,6,6-DODECAFLUOROHEPTANE |
| English Synonyms: | 2-(2,2,3,3,4,4,5,5,6,6,7,7-DODECAFLUORO-HEPTYLOXY)-DINITRO-TRIFLUORO-ME-BENZENE ; 7-[2,6-DINITRO-4-(TRIFLUOROMETHYL)PHENOXY]-1,1,2,2,3,3,4,4,5,5,6,6-DODECAFLUOROHEPTANE |
| MDL Number.: | MFCD00186636 |
| H bond acceptor: | 7 |
| H bond donor: | 0 |
| Smile: | c1c(cc(c(c1[N+](=O)[O-])OCC(C(C(C(C(C(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)[N+](=O)[O-])C(F)(F)F |
| InChi: | InChI=1S/C14H5F15N2O5/c15-8(16)10(19,20)13(26,27)14(28,29)12(24,25)9(17,18)3-36-7-5(30(32)33)1-4(11(21,22)23)2-6(7)31(34)35/h1-2,8H,3H2 |
| InChiKey: | InChIKey=QFGDWFOPCLTGAL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.