* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZX-IP004406 |
| English Synonyms: | ZERENEX ZX-IP004406 |
| MDL Number.: | MFCD00187918 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | C1[C@@H]([C@@H](CS1(=O)=O)Cl)Cl |
| InChi: | InChI=1S/C4H6Cl2O2S/c5-3-1-9(7,8)2-4(3)6/h3-4H,1-2H2/t3-,4+ |
| InChiKey: | InChIKey=JCUQWSIALJCIEE-ZXZARUISSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.