* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | HOLOCALIN |
CAS: | 41753-54-2 |
English Synonyms: | HOLOCALIN |
MDL Number.: | MFCD00189424 |
H bond acceptor: | 8 |
H bond donor: | 5 |
Smile: | c1cc(cc(c1)O)[C@H](C#N)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
InChi: | InChI=1S/C14H17NO7/c15-5-9(7-2-1-3-8(17)4-7)21-14-13(20)12(19)11(18)10(6-16)22-14/h1-4,9-14,16-20H,6H2/t9-,10+,11+,12-,13+,14+/m0/s1 |
InChiKey: | InChIKey=KCVXNPDAHDGXFD-GMDXDWKASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.