* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GLUCOSE, D-[2-14C] |
| CAS: | 3646-71-7 |
| English Synonyms: | GLUCOSE, D-[2-14C] |
| MDL Number.: | MFCD00189743 |
| H bond acceptor: | 6 |
| H bond donor: | 5 |
| Smile: | C([C@H]([C@H]([C@@H]([14C@H](C=O)O)O)O)O)O |
| InChi: | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4+,5+,6+/m0/s1/i3+2 |
| InChiKey: | InChIKey=GZCGUPFRVQAUEE-GZTHTRMUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.