* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | DL-GLUTAMIC ACID[1-14C] |
CAS: | 4219-82-3 |
English Synonyms: | GLUTAMIC ACID DL-[1-14C] ; DL-GLUTAMIC ACID[1-14C] |
MDL Number.: | MFCD00189757 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | C(CC(=O)O)C([14C](=O)O)N |
InChi: | InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/i5+2 |
InChiKey: | InChIKey=WHUUTDBJXJRKMK-RHRFEJLCSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.