Molecular Structure:
CCD No.:CCD00089654
GLUTAMINE, L-[2,3,4-3H]
Formula:C5 H5 N2 O3 T5
MolWeight:156.186
![GLUTAMINE, L-[2,3,4-3H] Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(2)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | GLUTAMINE, L-[2,3,4-3H] |
| English Synonyms： | GLUTAMINE, L-[2,3,4-3H] |
| MDL Number.： | MFCD00189764 |
| H bond acceptor： | 5 |
| H bond donor： | 3 |
| Smile： | [3H]C([3H])(C(=O)N)C([3H])([3H])[C@@]([3H])(C(=O)O)N |
| InChiKey： | InChIKey=null |
|
|
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
