Molecular Structure:
CCD No.:CCD00089661
GLYCEROL-1,2,3-3H
CAS No.:
152558-61-7
;76550-75-9
Formula:C3 H3 O3 T5
MolWeight:102.134
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(2)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | GLYCEROL-1,2,3-3H |
| CAS： | 152558-61-7 ;76550-75-9 |
| English Synonyms： | GLYCEROL-1,2,3-3H |
| MDL Number.： | MFCD00189771 |
| H bond acceptor： | 3 |
| H bond donor： | 3 |
| Smile： | [3H]C([3H])(C([3H])(C([3H])([3H])O)O)O |
| InChiKey： | InChIKey=null |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
