* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GLYCOLIC ACID, CALCIUM SALT, [2-14C] |
| English Synonyms: | GLYCOLIC ACID, CALCIUM SALT, [2-14C] |
| MDL Number.: | MFCD00189781 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | [14CH2](C(=O)O[Ca]OC(=O)[14CH2]O)O |
| InChi: | InChI=1S/2C2H4O3.Ca/c2*3-1-2(4)5;/h2*3H,1H2,(H,4,5);/q;;+2/p-2/i2*1+2; |
| InChiKey: | InChIKey=CHRHZFQUDFAQEQ-AAZDLJAQSA-L |
* If the product has intellectual property rights, a license granted is must or contact us.