Molecular Structure:
CCD No.:CCD00089698
IBUPROFEN, RS, [3H(G)]
Formula:C13 H17 O2 T
MolWeight:208.291
![IBUPROFEN, RS, [3H(G)] Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | IBUPROFEN, RS, [3H(G)] |
| English Synonyms： | IBUPROFEN, RS, [3H(G)] |
| MDL Number.： | MFCD00189813 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | [3H]c1cc(ccc1C(C)C(=O)O)CC(C)C |
| InChiKey： | InChIKey=null |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
